About 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine
2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine (PubChem CID 162765862) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine.
Molecular Properties
| Compound Name | 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine |
| PubChem CID | 162765862 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine |
| SMILES | FC1CC2=CCCN2C1 |
| InChI | InChI=1S/C7H10FN/c8-6-4-7-2-1-3-9(7)5-6/h2,6H,1,3-5H2 |
| InChIKey | TYRHYPBOTCFWTL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
The IUPAC name of 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine (CID 162765862) is 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine.
What is the SMILES notation for 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
The canonical SMILES for 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine is FC1CC2=CCCN2C1.
What is the InChIKey of 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
The InChIKey is TYRHYPBOTCFWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN/c8-6-4-7-2-1-3-9(7)5-6/h2,6H,1,3-5H2.
What are the key properties of 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine?
2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine has a molecular weight of 127.16 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2,3,5,6-tetrahydro-1H-pyrrolizine is sourced from PubChem (CID 162765862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).