C31H33FN6O4 — CID 162765997
3-[8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]-N-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 162765997) has the molecular formula C31H33FN6O4 and a molecular weight of 572.64 g/mol. Its IUPAC name is 3-[8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]-N-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | 3-[8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]-N-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 162765997 |
| Molecular Formula | C31H33FN6O4 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 3-[8-fluoro-7-(3-hydroxynaphthalen-1-yl)-2-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-4-yl]-N-hydroxy-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | CN1CCCC1COc1nc(N2CC3CCC(C2)N3C(=O)NO)c2ccc(-c3cc(O)cc4ccccc34)c(F)c2n1 |
| InChI | InChI=1S/C31H33FN6O4/c1-36-12-4-6-21(36)17-42-30-33-28-25(29(34-30)37-15-19-8-9-20(16-37)38(19)31(40)35-41)11-10-24(27(28)32)26-14-22(39)13-18-5-2-3-7-23(18)26/h2-3,5,7,10-11,13-14,19-21,39,41H,4,6,8-9,12,15-17H2,1H3,(H,35,40) |
| InChIKey | PEEZVEHQEYHPEZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|