C35H39FN6O3 — CID 162766059
3-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propanamide (PubChem CID 162766059) has the molecular formula C35H39FN6O3 and a molecular weight of 610.73 g/mol. Its IUPAC name is 3-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propanamide.
| Compound Name | 3-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propanamide |
|---|---|
| PubChem CID | 162766059 |
| Molecular Formula | C35H39FN6O3 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 3-[3-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]propanamide |
| SMILES | NC(=O)CCN1C2CCC1CN(c1nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cc(O)cc5ccccc45)ccc13)C2 |
| InChI | InChI=1S/C35H39FN6O3/c36-31-27(29-18-25(43)17-22-5-1-2-6-26(22)29)9-10-28-32(31)38-34(45-21-35-12-3-14-41(35)15-4-13-35)39-33(28)40-19-23-7-8-24(20-40)42(23)16-11-30(37)44/h1-2,5-6,9-10,17-18,23-24,43H,3-4,7-8,11-16,19-21H2,(H2,37,44) |
| InChIKey | RXXNDVJQQZHFAF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |