C31H36FN7O — CID 162766290
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,5-dimethyl-2H-indazol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline (PubChem CID 162766290) has the molecular formula C31H36FN7O and a molecular weight of 541.68 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,5-dimethyl-2H-indazol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,5-dimethyl-2H-indazol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline |
|---|---|
| PubChem CID | 162766290 |
| Molecular Formula | C31H36FN7O |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(3,5-dimethyl-2H-indazol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazoline |
| SMILES | Cc1ccc2n[nH]c(C)c2c1-c1ccc2c(N3CC4CCC(C3)N4)nc(OCC34CCCN3CCC4)nc2c1F |
| InChI | InChI=1S/C31H36FN7O/c1-18-5-10-24-26(19(2)36-37-24)25(18)22-8-9-23-28(27(22)32)34-30(40-17-31-11-3-13-39(31)14-4-12-31)35-29(23)38-15-20-6-7-21(16-38)33-20/h5,8-10,20-21,33H,3-4,6-7,11-17H2,1-2H3,(H,36,37) |
| InChIKey | WSDNYSXBPVHLKQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |