About 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine
9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine (PubChem CID 162767097) has the molecular formula C13H10BrClN6O2
and a molecular weight of 397.62 g/mol. Its IUPAC name is 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine.
Molecular Properties
| Compound Name | 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine |
| PubChem CID | 162767097 |
| Molecular Formula | C13H10BrClN6O2 |
| Molecular Weight | 397.62 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine |
| SMILES | Nc1nc(Cl)c2nc(N)n(Cc3cc4c(cc3Br)OCO4)c2n1 |
| InChI | InChI=1S/C13H10BrClN6O2/c14-6-2-8-7(22-4-23-8)1-5(6)3-21-11-9(18-13(21)17)10(15)19-12(16)20-11/h1-2H,3-4H2,(H2,17,18)(H2,16,19,20) |
| InChIKey | FTFFKSRGYUMYQY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine?
The IUPAC name of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine (CID 162767097) is 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine.
What is the SMILES notation for 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine?
The canonical SMILES for 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine is Nc1nc(Cl)c2nc(N)n(Cc3cc4c(cc3Br)OCO4)c2n1.
What is the InChIKey of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine?
The InChIKey is FTFFKSRGYUMYQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrClN6O2/c14-6-2-8-7(22-4-23-8)1-5(6)3-21-11-9(18-13(21)17)10(15)19-12(16)20-11/h1-2H,3-4H2,(H2,17,18)(H2,16,19,20).
What are the key properties of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine?
9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine has a molecular weight of 397.62 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurine-2,8-diamine is sourced from PubChem (CID 162767097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).