About 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one
2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 162767122) has the molecular formula C15H15ClN4O3
and a molecular weight of 334.76 g/mol. Its IUPAC name is 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 162767122 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | COc1cccc(CN2C(=O)Cc3c(Cl)nc(N)nc32)c1OC |
| InChI | InChI=1S/C15H15ClN4O3/c1-22-10-5-3-4-8(12(10)23-2)7-20-11(21)6-9-13(16)18-15(17)19-14(9)20/h3-5H,6-7H2,1-2H3,(H2,17,18,19) |
| InChIKey | IYVMQCXUYLQGHD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (CID 162767122) is 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one is COc1cccc(CN2C(=O)Cc3c(Cl)nc(N)nc32)c1OC.
What is the InChIKey of 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is IYVMQCXUYLQGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4O3/c1-22-10-5-3-4-8(12(10)23-2)7-20-11(21)6-9-13(16)18-15(17)19-14(9)20/h3-5H,6-7H2,1-2H3,(H2,17,18,19).
What are the key properties of 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one?
2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 334.76 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chloro-7-[(2,3-dimethoxyphenyl)methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 162767122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).