C30H36N2O2 — CID 162767640
(1R)-5-[2-[4-[2-[[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]ethyl]phenyl]ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 162767640) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is (1R)-5-[2-[4-[2-[[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]ethyl]phenyl]ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-5-[2-[4-[2-[[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]ethyl]phenyl]ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 162767640 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | (1R)-5-[2-[4-[2-[[(5R)-5-amino-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]ethyl]phenyl]ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1CCCc2c(OCCc3ccc(CCOc4cccc5c4CCC[C@H]5N)cc3)cccc21 |
| InChI | InChI=1S/C30H36N2O2/c31-27-9-1-7-25-23(27)5-3-11-29(25)33-19-17-21-13-15-22(16-14-21)18-20-34-30-12-4-6-24-26(30)8-2-10-28(24)32/h3-6,11-16,27-28H,1-2,7-10,17-20,31-32H2/t27-,28-/m1/s1 |
| InChIKey | OCHHVOXQDOPULF-VSGBNLITSA-N |
| XLogP | 5.60 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |