C14H17ClN4O3 — CID 162768021
tert-butyl N-[(1S)-1-[3-(2-chloro-4-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate (PubChem CID 162768021) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[3-(2-chloro-4-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[3-(2-chloro-4-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 162768021 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | tert-butyl N-[(1S)-1-[3-(2-chloro-4-pyridinyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1nc(-c2ccnc(Cl)c2)no1 |
| InChI | InChI=1S/C14H17ClN4O3/c1-8(17-13(20)21-14(2,3)4)12-18-11(19-22-12)9-5-6-16-10(15)7-9/h5-8H,1-4H3,(H,17,20)/t8-/m0/s1 |
| InChIKey | XCQWMZVEUADTCW-QMMMGPOBSA-N |
| XLogP | 3.37 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|