About 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol
3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol (PubChem CID 162768100) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol.
Molecular Properties
| Compound Name | 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol |
| PubChem CID | 162768100 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol |
| SMILES | OC1CCC(n2ccc3cncnc32)C1O |
| InChI | InChI=1S/C11H13N3O2/c15-9-2-1-8(10(9)16)14-4-3-7-5-12-6-13-11(7)14/h3-6,8-10,15-16H,1-2H2 |
| InChIKey | HZDVVVZVUHMHSJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol?
The IUPAC name of 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol (CID 162768100) is 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol.
What is the SMILES notation for 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol?
The canonical SMILES for 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol is OC1CCC(n2ccc3cncnc32)C1O.
What is the InChIKey of 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol?
The InChIKey is HZDVVVZVUHMHSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c15-9-2-1-8(10(9)16)14-4-3-7-5-12-6-13-11(7)14/h3-6,8-10,15-16H,1-2H2.
What are the key properties of 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol?
3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol has a molecular weight of 219.24 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolo[2,3-d]pyrimidin-7-ylcyclopentane-1,2-diol is sourced from PubChem (CID 162768100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).