C31H29Cl2N5O6S — CID 162768276
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 162768276) has the molecular formula C31H29Cl2N5O6S and a molecular weight of 670.57 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 162768276 |
| Molecular Formula | C31H29Cl2N5O6S |
| Molecular Weight | 670.57 g/mol |
| Exact Mass | 669.12 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc3c(c2)c(CC(C)C)cn3S(=O)(=O)c2ccc(C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C31H29Cl2N5O6S/c1-5-43-31(40)35-30(39)27(16-34)37-36-21-13-25(32)29(26(33)14-21)44-22-8-11-28-24(15-22)20(12-18(2)3)17-38(28)45(41,42)23-9-6-19(4)7-10-23/h6-11,13-15,17-18,36H,5,12H2,1-4H3,(H,35,39,40) |
| InChIKey | YZSQEPCLNDUHMC-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|