C15H14N4O2 — CID 162768734
methyl 2-[5-(2-methylpyrimidin-5-yl)-1H-indazol-7-yl]acetate (PubChem CID 162768734) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 2-[5-(2-methylpyrimidin-5-yl)-1H-indazol-7-yl]acetate.
| Compound Name | methyl 2-[5-(2-methylpyrimidin-5-yl)-1H-indazol-7-yl]acetate |
|---|---|
| PubChem CID | 162768734 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl 2-[5-(2-methylpyrimidin-5-yl)-1H-indazol-7-yl]acetate |
| SMILES | COC(=O)Cc1cc(-c2cnc(C)nc2)cc2cn[nH]c12 |
| InChI | InChI=1S/C15H14N4O2/c1-9-16-6-13(7-17-9)10-3-11(5-14(20)21-2)15-12(4-10)8-18-19-15/h3-4,6-8H,5H2,1-2H3,(H,18,19) |
| InChIKey | DQJGUVRYTCXZRV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |