About 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide
6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide (PubChem CID 162769158) has the molecular formula C13H26N4O2
and a molecular weight of 270.38 g/mol. Its IUPAC name is 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide.
Molecular Properties
| Compound Name | 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide |
| PubChem CID | 162769158 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)N/C(N)=N/C(C)(C)C |
| InChI | InChI=1S/C13H26N4O2/c1-10(18)15-9-7-5-6-8-11(19)16-12(14)17-13(2,3)4/h5-9H2,1-4H3,(H,15,18)(H3,14,16,17,19) |
| InChIKey | LAZABJZXWMDZOM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide?
The IUPAC name of 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide (CID 162769158) is 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide.
What is the SMILES notation for 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide?
The canonical SMILES for 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide is CC(=O)NCCCCCC(=O)N/C(N)=N/C(C)(C)C.
What is the InChIKey of 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide?
The InChIKey is LAZABJZXWMDZOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O2/c1-10(18)15-9-7-5-6-8-11(19)16-12(14)17-13(2,3)4/h5-9H2,1-4H3,(H,15,18)(H3,14,16,17,19).
What are the key properties of 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide?
6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide has a molecular weight of 270.38 g/mol, XLogP of 0.91, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetamido-N-(N'-tert-butylcarbamimidoyl)hexanamide is sourced from PubChem (CID 162769158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).