About 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine
4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine (PubChem CID 162769804) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine |
| PubChem CID | 162769804 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine |
| SMILES | CC(C)C1=CC(N)NC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C9H13F3N2/c1-5(2)6-3-7(9(10,11)12)14-8(13)4-6/h3-5,8,14H,13H2,1-2H3 |
| InChIKey | IWLLQMHLMAEEIN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine?
The IUPAC name of 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine (CID 162769804) is 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine.
What is the SMILES notation for 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine?
The canonical SMILES for 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine is CC(C)C1=CC(N)NC(C(F)(F)F)=C1.
What is the InChIKey of 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine?
The InChIKey is IWLLQMHLMAEEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2/c1-5(2)6-3-7(9(10,11)12)14-8(13)4-6/h3-5,8,14H,13H2,1-2H3.
What are the key properties of 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine?
4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine has a molecular weight of 206.21 g/mol, XLogP of 1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-6-(trifluoromethyl)-1,2-dihydropyridin-2-amine is sourced from PubChem (CID 162769804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).