C29H29ClN4O5 — CID 162769937
4-(2-chlorophenyl)-1-[3-[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]oxypropyl]piperidine-4-carbonitrile (PubChem CID 162769937) has the molecular formula C29H29ClN4O5 and a molecular weight of 549.03 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-1-[3-[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]oxypropyl]piperidine-4-carbonitrile.
| Compound Name | 4-(2-chlorophenyl)-1-[3-[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]oxypropyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 162769937 |
| Molecular Formula | C29H29ClN4O5 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 4-(2-chlorophenyl)-1-[3-[2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl]oxypropyl]piperidine-4-carbonitrile |
| SMILES | C[C@]1(N2C(=O)c3cccc(OCCCN4CCC(C#N)(c5ccccc5Cl)CC4)c3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C29H29ClN4O5/c1-28(11-10-23(35)32-27(28)38)34-25(36)19-6-4-9-22(24(19)26(34)37)39-17-5-14-33-15-12-29(18-31,13-16-33)20-7-2-3-8-21(20)30/h2-4,6-9H,5,10-17H2,1H3,(H,32,35,38)/t28-/m0/s1 |
| InChIKey | GPDUNGCIJDYMEG-NDEPHWFRSA-N |
| XLogP | 3.46 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|