C26H14Br2N2S+2 — CID 162770619
2,5-bis(8-bromonaphthalen-1-yl)-8λ4-thia-7,9-diazoniabicyclo[4.3.0]nona-1(9),2,4,6,7,8-hexaene (PubChem CID 162770619) has the molecular formula C26H14Br2N2S+2 and a molecular weight of 546.29 g/mol. Its IUPAC name is 2,5-bis(8-bromonaphthalen-1-yl)-8λ4-thia-7,9-diazoniabicyclo[4.3.0]nona-1(9),2,4,6,7,8-hexaene.
| Compound Name | 2,5-bis(8-bromonaphthalen-1-yl)-8λ4-thia-7,9-diazoniabicyclo[4.3.0]nona-1(9),2,4,6,7,8-hexaene |
|---|---|
| PubChem CID | 162770619 |
| Molecular Formula | C26H14Br2N2S+2 |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | 2,5-bis(8-bromonaphthalen-1-yl)-8λ4-thia-7,9-diazoniabicyclo[4.3.0]nona-1(9),2,4,6,7,8-hexaene |
| SMILES | Brc1cccc2cccc(-c3ccc(-c4cccc5cccc(Br)c45)c4c3=[N+]=S=[N+]=4)c12 |
| InChI | InChI=1S/C26H14Br2N2S/c27-21-11-3-7-15-5-1-9-17(23(15)21)19-13-14-20(26-25(19)29-31-30-26)18-10-2-6-16-8-4-12-22(28)24(16)18/h1-14H/q+2 |
| InChIKey | BUOVFEFBMARTOW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|