C24H25F2N7O2 — CID 162770784
2-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]-methylamino]ethyl formate (PubChem CID 162770784) has the molecular formula C24H25F2N7O2 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]-methylamino]ethyl formate.
| Compound Name | 2-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]-methylamino]ethyl formate |
|---|---|
| PubChem CID | 162770784 |
| Molecular Formula | C24H25F2N7O2 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-[[6-[[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]-methylamino]ethyl formate |
| SMILES | Cc1nc2c(F)cc(-c3nc(Nc4ccc(N(C)CCOC=O)cn4)ncc3F)cc2n1C(C)C |
| InChI | InChI=1S/C24H25F2N7O2/c1-14(2)33-15(3)29-23-18(25)9-16(10-20(23)33)22-19(26)12-28-24(31-22)30-21-6-5-17(11-27-21)32(4)7-8-35-13-34/h5-6,9-14H,7-8H2,1-4H3,(H,27,28,30,31) |
| InChIKey | OVIOKSDKCUXCCE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|