About 2-(4-ethylphenyl)-1,3,2-dioxaborepane
2-(4-ethylphenyl)-1,3,2-dioxaborepane (PubChem CID 162770912) has the molecular formula C12H17BO2
and a molecular weight of 204.08 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,3,2-dioxaborepane.
Molecular Properties
| Compound Name | 2-(4-ethylphenyl)-1,3,2-dioxaborepane |
| PubChem CID | 162770912 |
| Molecular Formula | C12H17BO2 |
| Molecular Weight | 204.08 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(4-ethylphenyl)-1,3,2-dioxaborepane |
| SMILES | CCc1ccc(B2OCCCCO2)cc1 |
| InChI | InChI=1S/C12H17BO2/c1-2-11-5-7-12(8-6-11)13-14-9-3-4-10-15-13/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | BUIPWOLXTHPBMO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.08 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethylphenyl)-1,3,2-dioxaborepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylphenyl)-1,3,2-dioxaborepane?
The IUPAC name of 2-(4-ethylphenyl)-1,3,2-dioxaborepane (CID 162770912) is 2-(4-ethylphenyl)-1,3,2-dioxaborepane.
What is the SMILES notation for 2-(4-ethylphenyl)-1,3,2-dioxaborepane?
The canonical SMILES for 2-(4-ethylphenyl)-1,3,2-dioxaborepane is CCc1ccc(B2OCCCCO2)cc1.
What is the InChIKey of 2-(4-ethylphenyl)-1,3,2-dioxaborepane?
The InChIKey is BUIPWOLXTHPBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BO2/c1-2-11-5-7-12(8-6-11)13-14-9-3-4-10-15-13/h5-8H,2-4,9-10H2,1H3.
What are the key properties of 2-(4-ethylphenyl)-1,3,2-dioxaborepane?
2-(4-ethylphenyl)-1,3,2-dioxaborepane has a molecular weight of 204.08 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylphenyl)-1,3,2-dioxaborepane is sourced from PubChem (CID 162770912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).