C24H29BO2 — CID 162770924
4-(4-ethylphenyl)-1,10,10-trimethyl-6-phenyl-3,5-dioxa-4-boratricyclo[5.2.1.02,6]decane (PubChem CID 162770924) has the molecular formula C24H29BO2 and a molecular weight of 360.31 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-1,10,10-trimethyl-6-phenyl-3,5-dioxa-4-boratricyclo[5.2.1.02,6]decane.
| Compound Name | 4-(4-ethylphenyl)-1,10,10-trimethyl-6-phenyl-3,5-dioxa-4-boratricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 162770924 |
| Molecular Formula | C24H29BO2 |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 4-(4-ethylphenyl)-1,10,10-trimethyl-6-phenyl-3,5-dioxa-4-boratricyclo[5.2.1.02,6]decane |
| SMILES | CCc1ccc(B2OC3C(c4ccccc4)(O2)C2CCC3(C)C2(C)C)cc1 |
| InChI | InChI=1S/C24H29BO2/c1-5-17-11-13-19(14-12-17)25-26-21-23(4)16-15-20(22(23,2)3)24(21,27-25)18-9-7-6-8-10-18/h6-14,20-21H,5,15-16H2,1-4H3 |
| InChIKey | FIYRBFKCKVFMGD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|