About imidazol-3-ide;iodogold;phenylmethanone
imidazol-3-ide;iodogold;phenylmethanone (PubChem CID 162771599) has the molecular formula C10H8AuIN2O-2
and a molecular weight of 496.06 g/mol. Its IUPAC name is imidazol-3-ide;iodogold;phenylmethanone.
Molecular Properties
| Compound Name | imidazol-3-ide;iodogold;phenylmethanone |
| PubChem CID | 162771599 |
| Molecular Formula | C10H8AuIN2O-2 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.94 |
| IUPAC Name | imidazol-3-ide;iodogold;phenylmethanone |
| SMILES | I[Au].O=[C-]c1ccccc1.c1c[n-]cn1 |
| InChI | InChI=1S/C7H5O.C3H3N2.Au.HI/c8-6-7-4-2-1-3-5-7;1-2-5-3-4-1;;/h1-5H;1-3H;;1H/q2*-1;+1;/p-1 |
| InChIKey | AMEFMGGLELIMFZ-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze imidazol-3-ide;iodogold;phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazol-3-ide;iodogold;phenylmethanone?
The IUPAC name of imidazol-3-ide;iodogold;phenylmethanone (CID 162771599) is imidazol-3-ide;iodogold;phenylmethanone.
What is the SMILES notation for imidazol-3-ide;iodogold;phenylmethanone?
The canonical SMILES for imidazol-3-ide;iodogold;phenylmethanone is I[Au].O=[C-]c1ccccc1.c1c[n-]cn1.
What is the InChIKey of imidazol-3-ide;iodogold;phenylmethanone?
The InChIKey is AMEFMGGLELIMFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5O.C3H3N2.Au.HI/c8-6-7-4-2-1-3-5-7;1-2-5-3-4-1;;/h1-5H;1-3H;;1H/q2*-1;+1;/p-1.
What are the key properties of imidazol-3-ide;iodogold;phenylmethanone?
imidazol-3-ide;iodogold;phenylmethanone has a molecular weight of 496.06 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imidazol-3-ide;iodogold;phenylmethanone is sourced from PubChem (CID 162771599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).