About (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate
(3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate (PubChem CID 162771701) has the molecular formula C11H10F3NO2
and a molecular weight of 245.20 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate.
Molecular Properties
| Compound Name | (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate |
| PubChem CID | 162771701 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate |
| SMILES | O=C(OCc1cc(F)c(F)c(F)c1)C1CCN1 |
| InChI | InChI=1S/C11H10F3NO2/c12-7-3-6(4-8(13)10(7)14)5-17-11(16)9-1-2-15-9/h3-4,9,15H,1-2,5H2 |
| InChIKey | PVASVKNXLOWQJT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate?
The IUPAC name of (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate (CID 162771701) is (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate.
What is the SMILES notation for (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate?
The canonical SMILES for (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate is O=C(OCc1cc(F)c(F)c(F)c1)C1CCN1.
What is the InChIKey of (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate?
The InChIKey is PVASVKNXLOWQJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO2/c12-7-3-6(4-8(13)10(7)14)5-17-11(16)9-1-2-15-9/h3-4,9,15H,1-2,5H2.
What are the key properties of (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate?
(3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate has a molecular weight of 245.20 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trifluorophenyl)methyl azetidine-2-carboxylate is sourced from PubChem (CID 162771701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).