C15H13F2I3O4 — CID 162771756
3-cyclopentyl-2,2-difluoro-3-(2,3,5-triiodobenzoyl)oxypropanoic acid (PubChem CID 162771756) has the molecular formula C15H13F2I3O4 and a molecular weight of 675.97 g/mol. Its IUPAC name is 3-cyclopentyl-2,2-difluoro-3-(2,3,5-triiodobenzoyl)oxypropanoic acid.
| Compound Name | 3-cyclopentyl-2,2-difluoro-3-(2,3,5-triiodobenzoyl)oxypropanoic acid |
|---|---|
| PubChem CID | 162771756 |
| Molecular Formula | C15H13F2I3O4 |
| Molecular Weight | 675.97 g/mol |
| Exact Mass | 675.79 |
| IUPAC Name | 3-cyclopentyl-2,2-difluoro-3-(2,3,5-triiodobenzoyl)oxypropanoic acid |
| SMILES | O=C(OC(C1CCCC1)C(F)(F)C(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C15H13F2I3O4/c16-15(17,14(22)23)12(7-3-1-2-4-7)24-13(21)9-5-8(18)6-10(19)11(9)20/h5-7,12H,1-4H2,(H,22,23) |
| InChIKey | LDOKZLWDPYBXFO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|