C24H24F6N4O4 — CID 162772638
(6R,12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol (PubChem CID 162772638) has the molecular formula C24H24F6N4O4 and a molecular weight of 546.47 g/mol. Its IUPAC name is (6R,12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol.
| Compound Name | (6R,12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol |
|---|---|
| PubChem CID | 162772638 |
| Molecular Formula | C24H24F6N4O4 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (6R,12R)-17-amino-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-8-ol |
| SMILES | C[C@@H]1CCCC(O)C[C@](OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2N)O1 |
| InChI | InChI=1S/C24H24F6N4O4/c1-13-6-5-9-15(35)11-22(24(28,29)30,36-12-14-7-3-2-4-8-14)21-34-33-20(38-21)18-17(31)10-16(23(25,26)27)19(32-18)37-13/h2-4,7-8,10,13,15,35H,5-6,9,11-12,31H2,1H3/t13-,15?,22-/m1/s1 |
| InChIKey | YVUKFEBZWXMKND-NFVADDEVSA-N |
| XLogP | 5.41 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |