C17H18F6N4O3 — CID 162772779
(6R,12S)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-6-ol (PubChem CID 162772779) has the molecular formula C17H18F6N4O3 and a molecular weight of 440.34 g/mol. Its IUPAC name is (6R,12S)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-6-ol.
| Compound Name | (6R,12S)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-6-ol |
|---|---|
| PubChem CID | 162772779 |
| Molecular Formula | C17H18F6N4O3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (6R,12S)-17-amino-12-methyl-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaen-6-ol |
| SMILES | C[C@H]1CCCCC[C@](O)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2N)O1 |
| InChI | InChI=1S/C17H18F6N4O3/c1-8-5-3-2-4-6-15(28,17(21,22)23)14-27-26-13(30-14)11-10(24)7-9(16(18,19)20)12(25-11)29-8/h7-8,28H,2-6,24H2,1H3/t8-,15+/m0/s1 |
| InChIKey | DLWARPJOYKCFJR-VXJOIVPMSA-N |
| XLogP | 4.21 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |