C25H23F6N3O4 — CID 162772874
[(6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaen-17-yl]methanol (PubChem CID 162772874) has the molecular formula C25H23F6N3O4 and a molecular weight of 543.46 g/mol. Its IUPAC name is [(6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaen-17-yl]methanol.
| Compound Name | [(6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaen-17-yl]methanol |
|---|---|
| PubChem CID | 162772874 |
| Molecular Formula | C25H23F6N3O4 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | [(6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaen-17-yl]methanol |
| SMILES | C[C@@H]1C/C=C\CC[C@](OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2CO)O1 |
| InChI | InChI=1S/C25H23F6N3O4/c1-15-8-4-3-7-11-23(25(29,30)31,36-14-16-9-5-2-6-10-16)22-34-33-21(38-22)19-17(13-35)12-18(24(26,27)28)20(32-19)37-15/h2-6,9-10,12,15,35H,7-8,11,13-14H2,1H3/b4-3-/t15-,23-/m1/s1 |
| InChIKey | DWDJXGNVNSEEHH-JSWITMAVSA-N |
| XLogP | 6.12 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|