About [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol
[2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol (PubChem CID 162773088) has the molecular formula C23H20N4O3S
and a molecular weight of 432.51 g/mol. Its IUPAC name is [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol.
Molecular Properties
| Compound Name | [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol |
| PubChem CID | 162773088 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol |
| SMILES | O=S(=O)(c1ccc(-n2ccnc2)cc1)N1Cc2cnc(C(O)c3ccccc3)cc2C1 |
| InChI | InChI=1S/C23H20N4O3S/c28-23(17-4-2-1-3-5-17)22-12-18-14-27(15-19(18)13-25-22)31(29,30)21-8-6-20(7-9-21)26-11-10-24-16-26/h1-13,16,23,28H,14-15H2 |
| InChIKey | AQLLUEPJEOFBHK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol?
The IUPAC name of [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol (CID 162773088) is [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol.
What is the SMILES notation for [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol?
The canonical SMILES for [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol is O=S(=O)(c1ccc(-n2ccnc2)cc1)N1Cc2cnc(C(O)c3ccccc3)cc2C1.
What is the InChIKey of [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol?
The InChIKey is AQLLUEPJEOFBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3S/c28-23(17-4-2-1-3-5-17)22-12-18-14-27(15-19(18)13-25-22)31(29,30)21-8-6-20(7-9-21)26-11-10-24-16-26/h1-13,16,23,28H,14-15H2.
What are the key properties of [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol?
[2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol has a molecular weight of 432.51 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-imidazol-1-ylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenylmethanol is sourced from PubChem (CID 162773088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).