C24H25N7O — CID 162773738
1-[4-(4-isocyanophenoxy)cyclohexyl]-N-methyl-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-c]pyridin-6-amine (PubChem CID 162773738) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[4-(4-isocyanophenoxy)cyclohexyl]-N-methyl-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-c]pyridin-6-amine.
| Compound Name | 1-[4-(4-isocyanophenoxy)cyclohexyl]-N-methyl-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-c]pyridin-6-amine |
|---|---|
| PubChem CID | 162773738 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[4-(4-isocyanophenoxy)cyclohexyl]-N-methyl-3-(1-methylpyrazol-4-yl)pyrazolo[4,3-c]pyridin-6-amine |
| SMILES | [C-]#[N+]c1ccc(OC2CCC(n3nc(-c4cnn(C)c4)c4cnc(NC)cc43)CC2)cc1 |
| InChI | InChI=1S/C24H25N7O/c1-25-17-4-8-19(9-5-17)32-20-10-6-18(7-11-20)31-22-12-23(26-2)27-14-21(22)24(29-31)16-13-28-30(3)15-16/h4-5,8-9,12-15,18,20H,6-7,10-11H2,2-3H3,(H,26,27) |
| InChIKey | GSFWAHXQHGERDA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|