C19H36O4Si — CID 162773773
(2E,4Z)-5-[(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yloxyoxan-2-yl]penta-2,4-dien-1-ol (PubChem CID 162773773) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (2E,4Z)-5-[(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yloxyoxan-2-yl]penta-2,4-dien-1-ol.
| Compound Name | (2E,4Z)-5-[(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yloxyoxan-2-yl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 162773773 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (2E,4Z)-5-[(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-propan-2-yloxyoxan-2-yl]penta-2,4-dien-1-ol |
| SMILES | CC(C)O[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C\C=C\CO)O1 |
| InChI | InChI=1S/C19H36O4Si/c1-15(2)21-18-13-12-17(23-24(6,7)19(3,4)5)16(22-18)11-9-8-10-14-20/h8-11,15-18,20H,12-14H2,1-7H3/b10-8+,11-9-/t16-,17+,18+/m1/s1 |
| InChIKey | MHPNTOUUMVCYDM-MSDZQTSRSA-N |
| XLogP | 4.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|