C25H36O9 — CID 162773774
[(R)-[(2R,4S,5R)-4-butoxy-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-oxooxolan-2-yl]-[(2R,6R)-5-oxo-2-prop-2-enyl-2H-pyran-6-yl]methyl] acetate (PubChem CID 162773774) has the molecular formula C25H36O9 and a molecular weight of 480.55 g/mol. Its IUPAC name is [(R)-[(2R,4S,5R)-4-butoxy-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-oxooxolan-2-yl]-[(2R,6R)-5-oxo-2-prop-2-enyl-2H-pyran-6-yl]methyl] acetate.
| Compound Name | [(R)-[(2R,4S,5R)-4-butoxy-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-oxooxolan-2-yl]-[(2R,6R)-5-oxo-2-prop-2-enyl-2H-pyran-6-yl]methyl] acetate |
|---|---|
| PubChem CID | 162773774 |
| Molecular Formula | C25H36O9 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [(R)-[(2R,4S,5R)-4-butoxy-5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-oxooxolan-2-yl]-[(2R,6R)-5-oxo-2-prop-2-enyl-2H-pyran-6-yl]methyl] acetate |
| SMILES | C=CC[C@@H]1C=CC(=O)[C@@H]([C@@H](OC(C)=O)[C@H]2O[C@H](CC3COC(C)(C)O3)[C@H](OCCCC)C2=O)O1 |
| InChI | InChI=1S/C25H36O9/c1-6-8-12-29-22-19(13-17-14-30-25(4,5)34-17)33-23(20(22)28)24(31-15(3)26)21-18(27)11-10-16(32-21)9-7-2/h7,10-11,16-17,19,21-24H,2,6,8-9,12-14H2,1,3-5H3/t16-,17?,19-,21+,22+,23+,24-/m1/s1 |
| InChIKey | DWOUQUDNCYSOFQ-YQSVGHNASA-N |
| XLogP | 2.45 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|