C20H34O7Si — CID 162773779
methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate (PubChem CID 162773779) has the molecular formula C20H34O7Si and a molecular weight of 414.57 g/mol. Its IUPAC name is methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
|---|---|
| PubChem CID | 162773779 |
| Molecular Formula | C20H34O7Si |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | methyl 2-[(1S,2S,6R,7S,9S,12R)-7-[(E,1S)-1-hydroxy-3-trimethylsilylprop-2-enyl]-4,4-dimethyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecan-12-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@@H]([C@@H](O)/C=C/[Si](C)(C)C)[C@H]3OC(C)(C)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C20H34O7Si/c1-20(2)26-18-16(13(21)9-10-28(4,5)6)25-14-8-7-12(11-15(22)23-3)24-17(14)19(18)27-20/h9-10,12-14,16-19,21H,7-8,11H2,1-6H3/b10-9+/t12-,13+,14+,16+,17+,18-,19+/m1/s1 |
| InChIKey | ISCGVBUYIUKNKW-MEHWCIODSA-N |
| XLogP | 2.18 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|