C21H32O9 — CID 162773787
methyl (E)-5-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]pent-3-enoate (PubChem CID 162773787) has the molecular formula C21H32O9 and a molecular weight of 428.48 g/mol. Its IUPAC name is methyl (E)-5-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]pent-3-enoate.
| Compound Name | methyl (E)-5-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]pent-3-enoate |
|---|---|
| PubChem CID | 162773787 |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | methyl (E)-5-[(3aR,4S,6S,7S,7aR)-7-acetyloxy-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]pent-3-enoate |
| SMILES | COC(=O)C/C=C/C[C@@H]1O[C@@H](C2COC(C)(C)O2)[C@H]2OC(C)(C)O[C@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H32O9/c1-12(22)26-16-13(9-7-8-10-15(23)24-6)27-17(14-11-25-20(2,3)28-14)19-18(16)29-21(4,5)30-19/h7-8,13-14,16-19H,9-11H2,1-6H3/b8-7+/t13-,14?,16-,17-,18-,19+/m0/s1 |
| InChIKey | CECLOGNGQZQRJY-UJWVLDFDSA-N |
| XLogP | 1.87 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|