C56H35N5 — CID 162774119
2-[3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]-4-carbazol-9-yl-6-(N-phenylanilino)benzene-1,3-dicarbonitrile (PubChem CID 162774119) has the molecular formula C56H35N5 and a molecular weight of 787.99 g/mol. Its IUPAC name is 2-[3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]-4-carbazol-9-yl-6-(N-phenylanilino)benzene-1,3-dicarbonitrile.
| Compound Name | 2-[3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]-4-carbazol-9-yl-6-(N-phenylanilino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 162774119 |
| Molecular Formula | C56H35N5 |
| Molecular Weight | 787.99 g/mol |
| Exact Mass | 787.35 |
| IUPAC Name | 2-[3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazol-9-yl]-4-carbazol-9-yl-6-(N-phenylanilino)benzene-1,3-dicarbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)c2cc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])ccc2n3-c2c(C#N)c(N(c3ccccc3)c3ccccc3)cc(-n3c4ccccc4c4ccccc43)c2C#N)c([2H])c1[2H] |
| InChI | InChI=1S/C56H35N5/c57-36-48-54(59(42-21-9-3-10-22-42)43-23-11-4-12-24-43)35-55(60-50-27-15-13-25-44(50)45-26-14-16-28-51(45)60)49(37-58)56(48)61-52-31-29-40(38-17-5-1-6-18-38)33-46(52)47-34-41(30-32-53(47)61)39-19-7-2-8-20-39/h1-35H/i1D,2D,5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | WYCJBVHIFZHUKD-TZAYFOPYSA-N |
| XLogP | 14.43 |
| TPSA | 60.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.99 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |