C22H29NO15 — CID 162774406
(2,5-dioxopyrrolidin-1-yl) 2-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]acetate (PubChem CID 162774406) has the molecular formula C22H29NO15 and a molecular weight of 547.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]acetate |
|---|---|
| PubChem CID | 162774406 |
| Molecular Formula | C22H29NO15 |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethoxy]acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCOCC(=O)ON2C(=O)CCC2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H29NO15/c1-11(24)33-9-15-19(34-12(2)25)20(35-13(3)26)21(36-14(4)27)22(37-15)32-8-7-31-10-18(30)38-23-16(28)5-6-17(23)29/h15,19-22H,5-10H2,1-4H3/t15-,19-,20+,21-,22-/m1/s1 |
| InChIKey | UCNGWLRGZDMUGO-TVONUNMFSA-N |
| XLogP | -1.29 |
| TPSA | 196.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|