C54H33N7S — CID 162774911
6-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4-(4-phenylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 162774911) has the molecular formula C54H33N7S and a molecular weight of 811.97 g/mol. Its IUPAC name is 6-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4-(4-phenylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4-(4-phenylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 162774911 |
| Molecular Formula | C54H33N7S |
| Molecular Weight | 811.97 g/mol |
| Exact Mass | 811.25 |
| IUPAC Name | 6-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-4-(4-phenylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc(-n7c8ccccc8c8ccccc87)cc6)n5)cc4)c4sc5ncccc5c4n3)cc2)cc1 |
| InChI | InChI=1S/C54H33N7S/c1-3-12-34(13-4-1)35-21-25-38(26-22-35)50-56-47(49-48(57-50)44-18-11-33-55-54(44)62-49)36-23-27-39(28-24-36)52-58-51(37-14-5-2-6-15-37)59-53(60-52)40-29-31-41(32-30-40)61-45-19-9-7-16-42(45)43-17-8-10-20-46(43)61/h1-33H |
| InChIKey | WZDOGVCSLOMHCJ-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.97 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |