C55H34N4 — CID 162776463
2-[3-(7-isocyano-9,9-diphenylfluoren-4-yl)phenyl]-4,6-dinaphthalen-1-yl-1,3,5-triazine (PubChem CID 162776463) has the molecular formula C55H34N4 and a molecular weight of 750.91 g/mol. Its IUPAC name is 2-[3-(7-isocyano-9,9-diphenylfluoren-4-yl)phenyl]-4,6-dinaphthalen-1-yl-1,3,5-triazine.
| Compound Name | 2-[3-(7-isocyano-9,9-diphenylfluoren-4-yl)phenyl]-4,6-dinaphthalen-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 162776463 |
| Molecular Formula | C55H34N4 |
| Molecular Weight | 750.91 g/mol |
| Exact Mass | 750.28 |
| IUPAC Name | 2-[3-(7-isocyano-9,9-diphenylfluoren-4-yl)phenyl]-4,6-dinaphthalen-1-yl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cccc(-c3cccc(-c4nc(-c5cccc6ccccc56)nc(-c5cccc6ccccc56)n4)c3)c1-2 |
| InChI | InChI=1S/C55H34N4/c1-56-42-32-33-48-50(35-42)55(40-22-4-2-5-23-40,41-24-6-3-7-25-41)49-31-15-28-45(51(48)49)38-20-12-21-39(34-38)52-57-53(46-29-13-18-36-16-8-10-26-43(36)46)59-54(58-52)47-30-14-19-37-17-9-11-27-44(37)47/h2-35H |
| InChIKey | ZRDRGZVLQZNWAU-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.91 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|