C26H29BFN3O3 — CID 162777046
7-[2-fluoro-6-methoxy-3-[(1R,2R,6S,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]cinnolin-4-amine (PubChem CID 162777046) has the molecular formula C26H29BFN3O3 and a molecular weight of 461.35 g/mol. Its IUPAC name is 7-[2-fluoro-6-methoxy-3-[(1R,2R,6S,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]cinnolin-4-amine.
| Compound Name | 7-[2-fluoro-6-methoxy-3-[(1R,2R,6S,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]cinnolin-4-amine |
|---|---|
| PubChem CID | 162777046 |
| Molecular Formula | C26H29BFN3O3 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 7-[2-fluoro-6-methoxy-3-[(1R,2R,6S,8R)-2,6,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]cinnolin-4-amine |
| SMILES | COc1ccc(B2O[C@@]3(C)C[C@H]4C[C@H](C4(C)C)[C@@]3(C)O2)c(F)c1-c1ccc2c(N)cnnc2c1 |
| InChI | InChI=1S/C26H29BFN3O3/c1-24(2)15-11-21(24)26(4)25(3,12-15)33-27(34-26)17-8-9-20(32-5)22(23(17)28)14-6-7-16-18(29)13-30-31-19(16)10-14/h6-10,13,15,21H,11-12H2,1-5H3,(H2,29,31)/t15-,21-,25+,26-/m1/s1 |
| InChIKey | YKSMRTCFENWQKA-YWBSNGEMSA-N |
| XLogP | 4.35 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|