About CID 162777364
CID 162777364 (PubChem CID 162777364) has the molecular formula C42H33N3O2PtS
and a molecular weight of 838.89 g/mol.
Molecular Properties
| Compound Name | CID 162777364 |
| PubChem CID | 162777364 |
| Molecular Formula | C42H33N3O2PtS |
| Molecular Weight | 838.89 g/mol |
| Exact Mass | 838.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(Oc2nc(-n3c4[c-]cccc4c4ccccc43)ccc2C(C)(C)C)nc(-c2[c-]c3oc4cccc5sc(c2)c3c45)c1.[Pt+2] |
| InChI | InChI=1S/C42H33N3O2S.Pt/c1-41(2,3)25-22-29(24-20-33-39-35(21-24)48-34-17-11-16-32(46-33)38(34)39)43-37(23-25)47-40-28(42(4,5)6)18-19-36(44-40)45-30-14-9-7-12-26(30)27-13-8-10-15-31(27)45;/h7-14,16-19,21-23H,1-6H3;/q-2;+2 |
| InChIKey | LSIJIUHBJBTFMY-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 838.89 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 162777364 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162777364?
The IUPAC name of CID 162777364 (CID 162777364) is not available.
What is the SMILES notation for CID 162777364?
The canonical SMILES for CID 162777364 is CC(C)(C)c1cc(Oc2nc(-n3c4[c-]cccc4c4ccccc43)ccc2C(C)(C)C)nc(-c2[c-]c3oc4cccc5sc(c2)c3c45)c1.[Pt+2].
What is the InChIKey of CID 162777364?
The InChIKey is LSIJIUHBJBTFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H33N3O2S.Pt/c1-41(2,3)25-22-29(24-20-33-39-35(21-24)48-34-17-11-16-32(46-33)38(34)39)43-37(23-25)47-40-28(42(4,5)6)18-19-36(44-40)45-30-14-9-7-12-26(30)27-13-8-10-15-31(27)45;/h7-14,16-19,21-23H,1-6H3;/q-2;+2.
What are the key properties of CID 162777364?
CID 162777364 has a molecular weight of 838.89 g/mol, XLogP of 11.78, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162777364 is sourced from PubChem (CID 162777364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).