C16H18N6O2 — CID 162777633
5-imidazol-1-yl-2-[3-[3-(methylamino)propoxy]-1,2,4-triazin-6-yl]phenol (PubChem CID 162777633) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-imidazol-1-yl-2-[3-[3-(methylamino)propoxy]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-imidazol-1-yl-2-[3-[3-(methylamino)propoxy]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 162777633 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-imidazol-1-yl-2-[3-[3-(methylamino)propoxy]-1,2,4-triazin-6-yl]phenol |
| SMILES | CNCCCOc1ncc(-c2ccc(-n3ccnc3)cc2O)nn1 |
| InChI | InChI=1S/C16H18N6O2/c1-17-5-2-8-24-16-19-10-14(20-21-16)13-4-3-12(9-15(13)23)22-7-6-18-11-22/h3-4,6-7,9-11,17,23H,2,5,8H2,1H3 |
| InChIKey | DVBMLWCANUAZNO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|