C21H21FN6O — CID 162777721
6-[3-[[(1R,2R,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]isoquinolin-7-ol (PubChem CID 162777721) has the molecular formula C21H21FN6O and a molecular weight of 392.44 g/mol. Its IUPAC name is 6-[3-[[(1R,2R,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]isoquinolin-7-ol.
| Compound Name | 6-[3-[[(1R,2R,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 162777721 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 6-[3-[[(1R,2R,3S,5R)-2-fluoro-1-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]-1,2,4-triazin-6-yl]isoquinolin-7-ol |
| SMILES | CN(c1ncc(-c2cc3ccncc3cc2O)nn1)[C@H]1C[C@@H]2C=C[C@@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C21H21FN6O/c1-21-5-3-14(25-21)9-17(19(21)22)28(2)20-24-11-16(26-27-20)15-7-12-4-6-23-10-13(12)8-18(15)29/h3-8,10-11,14,17,19,25,29H,9H2,1-2H3/t14-,17-,19+,21+/m0/s1 |
| InChIKey | VMKIRXLPFGYAJU-QBGRRASTSA-N |
| XLogP | 2.63 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|