C24H26FN7O2 — CID 162777800
4-[4-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one (PubChem CID 162777800) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is 4-[4-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one.
| Compound Name | 4-[4-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 162777800 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 4-[4-[3-[1-[(1S,2R,3S,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-1-methyl-1,3,5-triazin-2-one |
| SMILES | C=C(c1ncc(-c2ccc(-c3ncn(C)c(=O)n3)cc2O)nn1)[C@@H]1C[C@@]2(C)CC[C@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C24H26FN7O2/c1-13(16-10-23(2)7-8-24(3,31-23)19(16)25)20-26-11-17(29-30-20)15-6-5-14(9-18(15)33)21-27-12-32(4)22(34)28-21/h5-6,9,11-12,16,19,31,33H,1,7-8,10H2,2-4H3/t16-,19+,23+,24-/m0/s1 |
| InChIKey | BJEBQDNKAYDZHQ-FQWSXGTCSA-N |
| XLogP | 2.67 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |