C22H22FN7O — CID 162777967
2-[3-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(triazol-1-yl)phenol (PubChem CID 162777967) has the molecular formula C22H22FN7O and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-[3-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(triazol-1-yl)phenol.
| Compound Name | 2-[3-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(triazol-1-yl)phenol |
|---|---|
| PubChem CID | 162777967 |
| Molecular Formula | C22H22FN7O |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-[3-[1-[(1R,2R,3R,5R)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]ethenyl]-1,2,4-triazin-6-yl]-5-(triazol-1-yl)phenol |
| SMILES | C=C(c1ncc(-c2ccc(-n3ccnn3)cc2O)nn1)[C@H]1C[C@]2(C)C=C[C@@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C22H22FN7O/c1-13(16-11-21(2)6-7-22(3,28-21)19(16)23)20-24-12-17(26-27-20)15-5-4-14(10-18(15)31)30-9-8-25-29-30/h4-10,12,16,19,28,31H,1,11H2,2-3H3/t16-,19-,21+,22-/m1/s1 |
| InChIKey | QCYMAGFJZIBWIV-ZKMOHVOUSA-N |
| XLogP | 2.87 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|