C41H28N4O — CID 162778165
5-dibenzofuran-1-yl-8,8-dimethyl-4,11,12-triphenyl-3,6,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 162778165) has the molecular formula C41H28N4O and a molecular weight of 592.70 g/mol. Its IUPAC name is 5-dibenzofuran-1-yl-8,8-dimethyl-4,11,12-triphenyl-3,6,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 5-dibenzofuran-1-yl-8,8-dimethyl-4,11,12-triphenyl-3,6,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 162778165 |
| Molecular Formula | C41H28N4O |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 5-dibenzofuran-1-yl-8,8-dimethyl-4,11,12-triphenyl-3,6,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CC1(C)c2nc(-c3ccccc3)c(-c3ccccc3)nc2-c2nc(-c3ccccc3)c(-c3cccc4oc5ccccc5c34)nc21 |
| InChI | InChI=1S/C41H28N4O/c1-41(2)39-37(42-33(25-15-6-3-7-16-25)34(44-39)26-17-8-4-9-18-26)38-40(41)45-36(35(43-38)27-19-10-5-11-20-27)29-22-14-24-31-32(29)28-21-12-13-23-30(28)46-31/h3-24H,1-2H3 |
| InChIKey | BBNITFITINTCKQ-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |