C30H23N3 — CID 162778227
8,8-dimethyl-4,6,11-triphenyl-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 162778227) has the molecular formula C30H23N3 and a molecular weight of 425.54 g/mol. Its IUPAC name is 8,8-dimethyl-4,6,11-triphenyl-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8,8-dimethyl-4,6,11-triphenyl-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 162778227 |
| Molecular Formula | C30H23N3 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 8,8-dimethyl-4,6,11-triphenyl-3,5,12-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CC1(C)c2cc(-c3ccccc3)ncc2-c2nc(-c3ccccc3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C30H23N3/c1-30(2)24-18-25(20-12-6-3-7-13-20)31-19-23(24)28-26(30)27(21-14-8-4-9-15-21)32-29(33-28)22-16-10-5-11-17-22/h3-19H,1-2H3 |
| InChIKey | PWUPJCYXTQPCSH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |