About (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten
(1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten (PubChem CID 162779951) has the molecular formula C4H4N3O2W-
and a molecular weight of 309.94 g/mol. Its IUPAC name is (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten.
Molecular Properties
| Compound Name | (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten |
| PubChem CID | 162779951 |
| Molecular Formula | C4H4N3O2W- |
| Molecular Weight | 309.94 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten |
| SMILES | [CH2-]O/N=C(\C#N)C(N)=O.[W] |
| InChI | InChI=1S/C4H4N3O2.W/c1-9-7-3(2-5)4(6)8;/h1H2,(H2,6,8);/q-1;/b7-3+; |
| InChIKey | KRLYVVIEKPFCEA-CDQVLDCRSA-N |
| XLogP | -0.84 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.94 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten?
The IUPAC name of (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten (CID 162779951) is (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten.
What is the SMILES notation for (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten?
The canonical SMILES for (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten is [CH2-]O/N=C(\C#N)C(N)=O.[W].
What is the InChIKey of (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten?
The InChIKey is KRLYVVIEKPFCEA-CDQVLDCRSA-N. The full InChI is InChI=1S/C4H4N3O2.W/c1-9-7-3(2-5)4(6)8;/h1H2,(H2,6,8);/q-1;/b7-3+;.
What are the key properties of (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten?
(1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten has a molecular weight of 309.94 g/mol, XLogP of -0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2-amino-N-methanidyloxy-2-oxoethanimidoyl cyanide;tungsten is sourced from PubChem (CID 162779951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).