About [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate
[(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate (PubChem CID 162781158) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate.
Molecular Properties
| Compound Name | [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate |
| PubChem CID | 162781158 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate |
| SMILES | NC(=O)OC[C@H](F)C(F)C1CCCCC1 |
| InChI | InChI=1S/C10H17F2NO2/c11-8(6-15-10(13)14)9(12)7-4-2-1-3-5-7/h7-9H,1-6H2,(H2,13,14)/t8-,9?/m0/s1 |
| InChIKey | YNFFBGWXGNQIQW-IENPIDJESA-N |
| XLogP | 2.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate?
The IUPAC name of [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate (CID 162781158) is [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate.
What is the SMILES notation for [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate?
The canonical SMILES for [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate is NC(=O)OC[C@H](F)C(F)C1CCCCC1.
What is the InChIKey of [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate?
The InChIKey is YNFFBGWXGNQIQW-IENPIDJESA-N. The full InChI is InChI=1S/C10H17F2NO2/c11-8(6-15-10(13)14)9(12)7-4-2-1-3-5-7/h7-9H,1-6H2,(H2,13,14)/t8-,9?/m0/s1.
What are the key properties of [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate?
[(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate has a molecular weight of 221.25 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-cyclohexyl-2,3-difluoropropyl] carbamate is sourced from PubChem (CID 162781158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).