C11H21BN2O4 — CID 162781710
3a-(3-boronopropyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid (PubChem CID 162781710) has the molecular formula C11H21BN2O4 and a molecular weight of 256.11 g/mol. Its IUPAC name is 3a-(3-boronopropyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid.
| Compound Name | 3a-(3-boronopropyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid |
|---|---|
| PubChem CID | 162781710 |
| Molecular Formula | C11H21BN2O4 |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3a-(3-boronopropyl)-5-methyl-2,3,4,6-tetrahydro-1H-pyrrolo[2,3-c]pyrrole-6a-carboxylic acid |
| SMILES | CN1CC2(CCCB(O)O)CCNC2(C(=O)O)C1 |
| InChI | InChI=1S/C11H21BN2O4/c1-14-7-10(3-2-5-12(17)18)4-6-13-11(10,8-14)9(15)16/h13,17-18H,2-8H2,1H3,(H,15,16) |
| InChIKey | YNEVQAVQAMXBMK-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|