About 2-ethyl-1,2-dihydrobenzo[cd]indole
2-ethyl-1,2-dihydrobenzo[cd]indole (PubChem CID 162781792) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-ethyl-1,2-dihydrobenzo[cd]indole.
Molecular Properties
| Compound Name | 2-ethyl-1,2-dihydrobenzo[cd]indole |
| PubChem CID | 162781792 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-ethyl-1,2-dihydrobenzo[cd]indole |
| SMILES | CCC1Nc2cccc3cccc1c23 |
| InChI | InChI=1S/C13H13N/c1-2-11-10-7-3-5-9-6-4-8-12(14-11)13(9)10/h3-8,11,14H,2H2,1H3 |
| InChIKey | KBFPWYUETQNGJJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1,2-dihydrobenzo[cd]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,2-dihydrobenzo[cd]indole?
The IUPAC name of 2-ethyl-1,2-dihydrobenzo[cd]indole (CID 162781792) is 2-ethyl-1,2-dihydrobenzo[cd]indole.
What is the SMILES notation for 2-ethyl-1,2-dihydrobenzo[cd]indole?
The canonical SMILES for 2-ethyl-1,2-dihydrobenzo[cd]indole is CCC1Nc2cccc3cccc1c23.
What is the InChIKey of 2-ethyl-1,2-dihydrobenzo[cd]indole?
The InChIKey is KBFPWYUETQNGJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c1-2-11-10-7-3-5-9-6-4-8-12(14-11)13(9)10/h3-8,11,14H,2H2,1H3.
What are the key properties of 2-ethyl-1,2-dihydrobenzo[cd]indole?
2-ethyl-1,2-dihydrobenzo[cd]indole has a molecular weight of 183.25 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,2-dihydrobenzo[cd]indole is sourced from PubChem (CID 162781792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).