About 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine
5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine (PubChem CID 162782496) has the molecular formula C13H15FN2O2
and a molecular weight of 250.27 g/mol. Its IUPAC name is 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine |
| PubChem CID | 162782496 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine |
| SMILES | Fc1cnc(C23CCC4(CC2C3)OCCO4)nc1 |
| InChI | InChI=1S/C13H15FN2O2/c14-10-7-15-11(16-8-10)12-1-2-13(6-9(12)5-12)17-3-4-18-13/h7-9H,1-6H2 |
| InChIKey | SYSRMTQLCMBDCO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine?
The IUPAC name of 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine (CID 162782496) is 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine.
What is the SMILES notation for 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine?
The canonical SMILES for 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine is Fc1cnc(C23CCC4(CC2C3)OCCO4)nc1.
What is the InChIKey of 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine?
The InChIKey is SYSRMTQLCMBDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O2/c14-10-7-15-11(16-8-10)12-1-2-13(6-9(12)5-12)17-3-4-18-13/h7-9H,1-6H2.
What are the key properties of 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine?
5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine has a molecular weight of 250.27 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-spiro[1,3-dioxolane-2,4'-bicyclo[4.1.0]heptane]-1'-ylpyrimidine is sourced from PubChem (CID 162782496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).