C9H13N3O — CID 162782731
7-amino-2-methyl-5,6,7,8-tetrahydrocinnolin-3-one (PubChem CID 162782731) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 7-amino-2-methyl-5,6,7,8-tetrahydrocinnolin-3-one.
| Compound Name | 7-amino-2-methyl-5,6,7,8-tetrahydrocinnolin-3-one |
|---|---|
| PubChem CID | 162782731 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 7-amino-2-methyl-5,6,7,8-tetrahydrocinnolin-3-one |
| SMILES | Cn1nc2c(cc1=O)CCC(N)C2 |
| InChI | InChI=1S/C9H13N3O/c1-12-9(13)4-6-2-3-7(10)5-8(6)11-12/h4,7H,2-3,5,10H2,1H3 |
| InChIKey | AYQBMJPVIPASSE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |