C45H32N3OPt- — CID 162783991
2-[4-[9,9-dimethyl-1-(4-phenyl-2-pyridinyl)-2H-fluoren-2-id-3-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum (PubChem CID 162783991) has the molecular formula C45H32N3OPt- and a molecular weight of 825.85 g/mol. Its IUPAC name is 2-[4-[9,9-dimethyl-1-(4-phenyl-2-pyridinyl)-2H-fluoren-2-id-3-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[9,9-dimethyl-1-(4-phenyl-2-pyridinyl)-2H-fluoren-2-id-3-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 162783991 |
| Molecular Formula | C45H32N3OPt- |
| Molecular Weight | 825.85 g/mol |
| Exact Mass | 825.22 |
| IUPAC Name | 2-[4-[9,9-dimethyl-1-(4-phenyl-2-pyridinyl)-2H-fluoren-2-id-3-yl]-1-phenylbenzimidazol-2-yl]phenol;platinum |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cccc4c3nc(-c3ccccc3O)n4-c3ccccc3)[c-]c(-c3cc(-c4ccccc4)ccn3)c21.[Pt] |
| InChI | InChI=1S/C45H32N3O.Pt/c1-45(2)38-21-11-9-18-34(38)36-26-31(27-37(42(36)45)39-28-30(24-25-46-39)29-14-5-3-6-15-29)33-20-13-22-40-43(33)47-44(35-19-10-12-23-41(35)49)48(40)32-16-7-4-8-17-32;/h3-26,28,49H,1-2H3;/q-1; |
| InChIKey | ATUNIGPETZSGFW-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.85 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|