C17H14ClFN6O — CID 162784360
3-[(6-chloro-3-pyridinyl)methyl]-3-fluoro-1-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyrrolidin-2-one (PubChem CID 162784360) has the molecular formula C17H14ClFN6O and a molecular weight of 372.79 g/mol. Its IUPAC name is 3-[(6-chloro-3-pyridinyl)methyl]-3-fluoro-1-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyrrolidin-2-one.
| Compound Name | 3-[(6-chloro-3-pyridinyl)methyl]-3-fluoro-1-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 162784360 |
| Molecular Formula | C17H14ClFN6O |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-[(6-chloro-3-pyridinyl)methyl]-3-fluoro-1-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyrrolidin-2-one |
| SMILES | O=C1N(c2n[nH]c(-c3ccncc3)n2)CCC1(F)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H14ClFN6O/c18-13-2-1-11(10-21-13)9-17(19)5-8-25(15(17)26)16-22-14(23-24-16)12-3-6-20-7-4-12/h1-4,6-7,10H,5,8-9H2,(H,22,23,24) |
| InChIKey | PTPIIQALDISNNZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|